CAS 1240597-20-9 appears in our catalog under these names: 6-(Propan-2-yloxy)pyridine-2-carboxylic acid, 95%, 6-Isopropoxypicolinic acid, 97%, 6-(Propan-2-yloxy)pyridine-2-carboxylic acid. Offered by: Combi-blocks, AmBeed, Biosynth. Available pack sizes: 1g, 100mg, 250mg, 5g, 10g, 50mg, 0,5g.
6-propan-2-yloxypyridine-2-carboxylic acid (CAS 1240597-20-9) is a chemical compound with the molecular formula C9H11NO3 and a molecular weight of 181.19 g/mol. IUPAC name: 6-propan-2-yloxypyridine-2-carboxylic acid. InChIKey: JRSQAZFZVOWWTO-UHFFFAOYSA-N.
| Molecular formula | C9H11NO3 |
|---|---|
| Molecular weight | 181.19 g/mol |
| IUPAC name | 6-propan-2-yloxypyridine-2-carboxylic acid |
| InChIKey | JRSQAZFZVOWWTO-UHFFFAOYSA-N |
| SMILES | CC(C)OC1=CC=CC(=N1)C(=O)O |
Computed by PubChem (NCBI)