cas: 717-74-8 — see every product listed under this CAS number, including other names
1,3,5-Triisopropylbenzene 95% (CAS 717-74-8) is a chemical reagent available from Chemat. Available pack sizes: 25g, 100g, 500g, 1000g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A417498-25g |
| cas | 717-74-8 |
| size | 25g |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 25g | 142.31 Pln | |
| Ambeed | 100g | 270.25 Pln | |
| Ambeed | 500g | 854.31 Pln | |
| Ambeed | 1000g | 1377.19 Pln |
| purity | 95% |
|---|---|
| delivery time | 1-2 weeks |
| ambeed catalog no. | A417498 |
1,3,5-tri(propan-2-yl)benzene (CAS 717-74-8) is a chemical compound with the molecular formula C15H24 and a molecular weight of 204.35 g/mol. IUPAC name: 1,3,5-tri(propan-2-yl)benzene. InChIKey: VUMCUSHVMYIRMB-UHFFFAOYSA-N.
| Molecular formula | C15H24 |
|---|---|
| Molecular weight | 204.35 g/mol |
| IUPAC name | 1,3,5-tri(propan-2-yl)benzene |
| InChIKey | VUMCUSHVMYIRMB-UHFFFAOYSA-N |
| SMILES | CC(C)C1=CC(=CC(=C1)C(C)C)C(C)C |
Computed by PubChem (NCBI)