cas: 717-74-8 — see every product listed under this CAS number, including other names
1,3,5-Triisopropylbenzene, >95.0%(GC) (CAS 717-74-8) is a chemical reagent available from Chemat. Available pack sizes: 25ml, 100ml, 500ml. Offered by: TCI.
| brand | TCI |
|---|---|
| catalog number | T0458-25ML |
| cas | 717-74-8 |
| size | 25ml |
| availability | 2 tygodnie|2 weeks |
| brand | size | price | |
|---|---|---|---|
| TCI | 25ml | 98.68 Pln | |
| TCI | 100ml | 177.35 Pln | |
| TCI | 500ml | 521.56 Pln |
| delivery time | 2 weeks |
|---|---|
| category | chemicals |
| purity | >95.0%(GC) |
1,3,5-tri(propan-2-yl)benzene (CAS 717-74-8) is a chemical compound with the molecular formula C15H24 and a molecular weight of 204.35 g/mol. IUPAC name: 1,3,5-tri(propan-2-yl)benzene. InChIKey: VUMCUSHVMYIRMB-UHFFFAOYSA-N.
| Molecular formula | C15H24 |
|---|---|
| Molecular weight | 204.35 g/mol |
| IUPAC name | 1,3,5-tri(propan-2-yl)benzene |
| InChIKey | VUMCUSHVMYIRMB-UHFFFAOYSA-N |
| SMILES | CC(C)C1=CC(=CC(=C1)C(C)C)C(C)C |
Computed by PubChem (NCBI)