cas: 717-74-8 — see every product listed under this CAS number, including other names
1,3,5-Triisopropylbenzene (CAS 717-74-8) is a chemical reagent available from Chemat. Available pack sizes: 1g, 0,25kg, 1x1000mg, 25ml, 25g, 100g, 500g, 1kg. Offered by: Dr. Ehrenstorfer, Biosynth, HPC Standards, Fluorochem.
| brand | Dr. Ehrenstorfer |
|---|---|
| catalog number | DRE-C17871500 |
| cas | 717-74-8 |
| size | 1g |
| brand | size | price | |
|---|---|---|---|
| Dr. Ehrenstorfer | 1g | price on request | |
| Biosynth | 0,25kg | price on request | |
| HPC Standards | 1x1000mg | 366.15 Pln | |
| Fluorochem | 1g | 91.65 Pln | |
| Fluorochem | 25ml | 107.27 Pln | |
| Fluorochem | 25g | 112.48 Pln | |
| Fluorochem | 100g | 258.26 Pln | |
| Fluorochem | 500g | 987.17 Pln | |
| Fluorochem | 1kg | 1924.34 Pln |
| purity | No data |
|---|---|
| delivery time | To be confirmed by Chemat |
1,3,5-tri(propan-2-yl)benzene (CAS 717-74-8) is a chemical compound with the molecular formula C15H24 and a molecular weight of 204.35 g/mol. IUPAC name: 1,3,5-tri(propan-2-yl)benzene. InChIKey: VUMCUSHVMYIRMB-UHFFFAOYSA-N.
| Molecular formula | C15H24 |
|---|---|
| Molecular weight | 204.35 g/mol |
| IUPAC name | 1,3,5-tri(propan-2-yl)benzene |
| InChIKey | VUMCUSHVMYIRMB-UHFFFAOYSA-N |
| SMILES | CC(C)C1=CC(=CC(=C1)C(C)C)C(C)C |
Computed by PubChem (NCBI)