cas: 717-74-8 — see every product listed under this CAS number, including other names
1,3,5-Triisopropylbenzene, 98.70% (CAS 717-74-8) is a chemical reagent available from Chemat. Available pack sizes: 100 g, 10 g, 10mM/1mL, 5 g, 25 g, 50 g. Offered by: MedChemExpress.
| brand | MedChemExpress |
|---|---|
| catalog number | HY-W012472-100 g |
| cas | 717-74-8 |
| size | 100 g |
| availability | In stock |
| brand | size | price | |
|---|---|---|---|
| MedChemExpress | 100 g | 505.45 Pln | |
| MedChemExpress | 10 g | 263.96 Pln | |
| MedChemExpress | 10mM/1mL | 254.68 Pln | |
| MedChemExpress | 5 g | 240.74 Pln | |
| MedChemExpress | 25 g | 333.62 Pln | |
| MedChemExpress | 50 g | 407.93 Pln |
| delivery time | 2-3 weeks |
|---|---|
| purity | 98.70% |
1,3,5-tri(propan-2-yl)benzene (CAS 717-74-8) is a chemical compound with the molecular formula C15H24 and a molecular weight of 204.35 g/mol. IUPAC name: 1,3,5-tri(propan-2-yl)benzene. InChIKey: VUMCUSHVMYIRMB-UHFFFAOYSA-N.
| Molecular formula | C15H24 |
|---|---|
| Molecular weight | 204.35 g/mol |
| IUPAC name | 1,3,5-tri(propan-2-yl)benzene |
| InChIKey | VUMCUSHVMYIRMB-UHFFFAOYSA-N |
| SMILES | CC(C)C1=CC(=CC(=C1)C(C)C)C(C)C |
Computed by PubChem (NCBI)