cas: 717-74-8 — see every product listed under this CAS number, including other names
1,3,5-Triisopropylbenzene, 95%, 95% (CAS 717-74-8) is a chemical reagent available from Chemat. Available pack sizes: 1kg, 10g, 25g, 100g, 500g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch114DGI-1kg |
| cas | 717-74-8 |
| size | 1kg |
| availability | 5000g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 1kg | 866.00 Pln | |
| Chemat | 10g | 78.80 Pln | |
| Chemat | 25g | 83.60 Pln | |
| Chemat | 100g | 131.60 Pln | |
| Chemat | 500g | 475.20 Pln |
| purity | 95% |
|---|---|
| delivery time | 3 weeks |
1,3,5-tri(propan-2-yl)benzene (CAS 717-74-8) is a chemical compound with the molecular formula C15H24 and a molecular weight of 204.35 g/mol. IUPAC name: 1,3,5-tri(propan-2-yl)benzene. InChIKey: VUMCUSHVMYIRMB-UHFFFAOYSA-N.
| Molecular formula | C15H24 |
|---|---|
| Molecular weight | 204.35 g/mol |
| IUPAC name | 1,3,5-tri(propan-2-yl)benzene |
| InChIKey | VUMCUSHVMYIRMB-UHFFFAOYSA-N |
| SMILES | CC(C)C1=CC(=CC(=C1)C(C)C)C(C)C |
Computed by PubChem (NCBI)