Products 341556-80-7
CAS 341556-80-7 is the registry number for (2E,2'E)-3,3'-([1,1'-Biphenyl]-4,4'-diyl)diacrylic acid, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
(E)-3-[4-[4-[(E)-2-carboxyethenyl]phenyl]phenyl]prop-2-enoic acid (CAS 341556-80-7) is a chemical compound with the molecular formula C18H14O4 and a molecular weight of 294.3 g/mol. IUPAC name: (E)-3-[4-[4-[(E)-2-carboxyethenyl]phenyl]phenyl]prop-2-enoic acid. InChIKey: UQHRHUDMDDNWFJ-YDWXAUTNSA-N.
| Molecular formula | C18H14O4 |
|---|---|
| Molecular weight | 294.3 g/mol |
| IUPAC name | (E)-3-[4-[4-[(E)-2-carboxyethenyl]phenyl]phenyl]prop-2-enoic acid |
| InChIKey | UQHRHUDMDDNWFJ-YDWXAUTNSA-N |
| SMILES | C1=CC(=CC=C1/C=C/C(=O)O)C2=CC=C(C=C2)/C=C/C(=O)O |
Computed by PubChem (NCBI)