Products 36326-57-5
CAS 36326-57-5 is the registry number for Rel-(11R,12R)-9,10-dihydro-9,10-ethanoanthracene-11,12-dicarboxylic acid, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
(15R,16R)-tetracyclo[6.6.2.02,7.09,14]hexadeca-2,4,6,9,11,13-hexaene-15,16-dicarboxylic acid (CAS 36326-57-5) is a chemical compound with the molecular formula C18H14O4 and a molecular weight of 294.3 g/mol. IUPAC name: (15R,16R)-tetracyclo[6.6.2.02,7.09,14]hexadeca-2,4,6,9,11,13-hexaene-15,16-dicarboxylic acid. InChIKey: NYMGGONMSRTFKV-QDIHITRGSA-N.
| Molecular formula | C18H14O4 |
|---|---|
| Molecular weight | 294.3 g/mol |
| IUPAC name | (15R,16R)-tetracyclo[6.6.2.02,7.09,14]hexadeca-2,4,6,9,11,13-hexaene-15,16-dicarboxylic acid |
| InChIKey | NYMGGONMSRTFKV-QDIHITRGSA-N |
| SMILES | C1=CC=C2C3[C@H]([C@@H](C(C2=C1)C4=CC=CC=C34)C(=O)O)C(=O)O |
Computed by PubChem (NCBI)