Products 244789-60-4
CAS 244789-60-4 is the registry number for 4,5,9,10-Tetrahydropyrene-2,7-dicarboxylic acid, 95%. Offered by: Chemat Brand. Available pack sizes: on request.
4,5,9,10-tetrahydropyrene-2,7-dicarboxylic acid (CAS 244789-60-4) is a chemical compound with the molecular formula C18H14O4 and a molecular weight of 294.3 g/mol. IUPAC name: 4,5,9,10-tetrahydropyrene-2,7-dicarboxylic acid. InChIKey: JIIUWPYGXWLJRT-UHFFFAOYSA-N.
| Molecular formula | C18H14O4 |
|---|---|
| Molecular weight | 294.3 g/mol |
| IUPAC name | 4,5,9,10-tetrahydropyrene-2,7-dicarboxylic acid |
| InChIKey | JIIUWPYGXWLJRT-UHFFFAOYSA-N |
| SMILES | C1CC2=CC(=CC3=C2C4=C(CC3)C=C(C=C41)C(=O)O)C(=O)O |
Computed by PubChem (NCBI)