cas: 94-01-9 — see every product listed under this CAS number, including other names
1,3-DIBENZOYLOXYBENZENE (CAS 94-01-9) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g, 25g, 100g, 500g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F842634-1G |
| cas | 94-01-9 |
| size | 1g |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 1g | 122.89 Pln | |
| Fluorochem | 5g | 216.61 Pln | |
| Fluorochem | 25g | 565.44 Pln | |
| Fluorochem | 100g | 1695.25 Pln | |
| Fluorochem | 500g | 6683.08 Pln |
| delivery time | 3-4 weeks |
|---|
(3-benzoyloxyphenyl) benzoate (CAS 94-01-9) is a chemical compound with the molecular formula C20H14O4 and a molecular weight of 318.3 g/mol. IUPAC name: (3-benzoyloxyphenyl) benzoate. InChIKey: SUQGLJRNDJRARS-UHFFFAOYSA-N.
| Molecular formula | C20H14O4 |
|---|---|
| Molecular weight | 318.3 g/mol |
| IUPAC name | (3-benzoyloxyphenyl) benzoate |
| InChIKey | SUQGLJRNDJRARS-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)C(=O)OC2=CC(=CC=C2)OC(=O)C3=CC=CC=C3 |
Computed by PubChem (NCBI)