CAS 744-45-6 appears in our catalog under these names: Diphenyl isophthalate, 97%, Isophthalic acid, bis-phenyl ester, Diphenyl isophthalate, Diphenyl Isophthalate, >99.0%(GC), DIPHENYL ISOPHTHALATE, 99%. Offered by: Combi-blocks, Dr. Ehrenstorfer, GLPBio, TCI, Sigma-Aldrich. Available pack sizes: 100g, 5g, 25g, 1g, 250mg, 10g, 1x250mg.
Diphenyl benzene-1,3-dicarboxylate (CAS 744-45-6) is a chemical compound with the molecular formula C20H14O4 and a molecular weight of 318.3 g/mol. IUPAC name: diphenyl benzene-1,3-dicarboxylate. InChIKey: FHESUNXRPBHDQM-UHFFFAOYSA-N.
| Molecular formula | C20H14O4 |
|---|---|
| Molecular weight | 318.3 g/mol |
| IUPAC name | diphenyl benzene-1,3-dicarboxylate |
| InChIKey | FHESUNXRPBHDQM-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)OC(=O)C2=CC(=CC=C2)C(=O)OC3=CC=CC=C3 |
Computed by PubChem (NCBI)