CAS 1238854-14-2 is the registry number for [1,1':4',1''-Terphenyl]-3,3''-dicarboxylic acid, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
3-[4-(3-carboxyphenyl)phenyl]benzoic acid (CAS 1238854-14-2) is a chemical compound with the molecular formula C20H14O4 and a molecular weight of 318.3 g/mol. IUPAC name: 3-[4-(3-carboxyphenyl)phenyl]benzoic acid. InChIKey: ZEIAOZOEKLAWBR-UHFFFAOYSA-N.
| Molecular formula | C20H14O4 |
|---|---|
| Molecular weight | 318.3 g/mol |
| IUPAC name | 3-[4-(3-carboxyphenyl)phenyl]benzoic acid |
| InChIKey | ZEIAOZOEKLAWBR-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC(=C1)C(=O)O)C2=CC=C(C=C2)C3=CC(=CC=C3)C(=O)O |
Computed by PubChem (NCBI)