CAS 94-01-9 appears in our catalog under these names: 1,3-Dibenzoyloxybenzene, 98%, 1,3-Dibenzoyloxybenzene, 98% , 1,3-Dibenzoyloxybenzene, >98.0%(GC), 1,3-Benzenediol, 1,3-dibenzoate, 98%(GC-MS),RG, 98%(GC-MS),RG, 1,3-DIBENZOYLOXYBENZENE. Offered by: Combi-blocks, Thermo Scientific (Alfa Aesar), TCI, Chemat, Fluorochem. Available pack sizes: 1g, 25g, 5g, 100g, 500g.
(3-benzoyloxyphenyl) benzoate (CAS 94-01-9) is a chemical compound with the molecular formula C20H14O4 and a molecular weight of 318.3 g/mol. IUPAC name: (3-benzoyloxyphenyl) benzoate. InChIKey: SUQGLJRNDJRARS-UHFFFAOYSA-N.
| Molecular formula | C20H14O4 |
|---|---|
| Molecular weight | 318.3 g/mol |
| IUPAC name | (3-benzoyloxyphenyl) benzoate |
| InChIKey | SUQGLJRNDJRARS-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)C(=O)OC2=CC(=CC=C2)OC(=O)C3=CC=CC=C3 |
Computed by PubChem (NCBI)