CAS 39215-21-9 appears in our catalog under these names: 1,1'-Bi(2,3-naphthodiol), 95%, (1,1'-Binaphthalene)-2,2',3,3'-tetraol, 98%, 2,2',3,3'–Tetrahydroxy–1,1'–binaphthyl, 2,2',3,3'-Tetrahydroxy-1,1'-binaphthyl, >98.0%(HPLC), 1,1'-BI(2,3-NAPHTHODIOL). Offered by: Combi-blocks, AmBeed, GLPBio, TCI, Chemat. Available pack sizes: 250mg, 1g, 100mg.
1-(2,3-dihydroxynaphthalen-1-yl)naphthalene-2,3-diol (CAS 39215-21-9) is a chemical compound with the molecular formula C20H14O4 and a molecular weight of 318.3 g/mol. IUPAC name: 1-(2,3-dihydroxynaphthalen-1-yl)naphthalene-2,3-diol. InChIKey: OOSHJGKXQBJASF-UHFFFAOYSA-N.
| Molecular formula | C20H14O4 |
|---|---|
| Molecular weight | 318.3 g/mol |
| IUPAC name | 1-(2,3-dihydroxynaphthalen-1-yl)naphthalene-2,3-diol |
| InChIKey | OOSHJGKXQBJASF-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)C=C(C(=C2C3=C(C(=CC4=CC=CC=C43)O)O)O)O |
Computed by PubChem (NCBI)