CAS 13962-92-0 appears in our catalog under these names: 2,5-Diphenylbenzene-1,4-dicarboxylic acid, 95%, (1,1':4',1''-Terphenyl)-2',5'-dicarboxylic acid, 98%, [1,1':4',1''-Terphenyl]-2',5'-dicarboxylic acid 98%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 1g, 5g, 100mg, 250mg.
2,5-diphenylterephthalic acid (CAS 13962-92-0) is a chemical compound with the molecular formula C20H14O4 and a molecular weight of 318.3 g/mol. IUPAC name: 2,5-diphenylterephthalic acid. InChIKey: XSLGXTDGDJULAR-UHFFFAOYSA-N.
| Molecular formula | C20H14O4 |
|---|---|
| Molecular weight | 318.3 g/mol |
| IUPAC name | 2,5-diphenylterephthalic acid |
| InChIKey | XSLGXTDGDJULAR-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)C2=CC(=C(C=C2C(=O)O)C3=CC=CC=C3)C(=O)O |
Computed by PubChem (NCBI)