Products 1539-04-4
CAS 1539-04-4 appears in our catalog under these names: Diphenyl terephthalate, 95%, Diphenyl terephthalate, Diphenyl Terephthalate, >98.0%(GC), Diphenyl terephthalate, 98%. Offered by: Combi-blocks, GLPBio, TCI, Fluorochem. Available pack sizes: 1g, 25g, 5g, 100g.
Diphenyl benzene-1,4-dicarboxylate (CAS 1539-04-4) is a chemical compound with the molecular formula C20H14O4 and a molecular weight of 318.3 g/mol. IUPAC name: diphenyl benzene-1,4-dicarboxylate. InChIKey: HPGJOUYGWKFYQW-UHFFFAOYSA-N.
| Molecular formula | C20H14O4 |
|---|---|
| Molecular weight | 318.3 g/mol |
| IUPAC name | diphenyl benzene-1,4-dicarboxylate |
| InChIKey | HPGJOUYGWKFYQW-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)OC(=O)C2=CC=C(C=C2)C(=O)OC3=CC=CC=C3 |
Computed by PubChem (NCBI)
Synonyms:
Diphenyl terephthalate, Terephthalic acid, diphenyl ester, 1,4-Benzenedicarboxylic acid, 1,4-diphenyl ester, Terephthalic acid, diphenyl ester (8CI), 1,4Benzenedicarboxylic acid, diphenyl ester, 1,4Benzenedicarboxylic acid, 1,4diphenyl ester, diphenyl benzene-1,4-dicarboxylate, 1,4-diphenyl benzene-1,4-dicarboxylate, DIPHENYLTEREPHTHALATE, terephthalic acid diphenyl ester