cas: 51145-74-5 — see every product listed under this CAS number, including other names
1,3-Diazaspiro[4.5]decane-2,4,8-trione, 97% (CAS 51145-74-5) is a chemical reagent available from Chemat. Available pack sizes: 500mg, 1g, 5g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F718429-500MG |
| cas | 51145-74-5 |
| size | 500mg |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 500mg | 1539.06 Pln | |
| Fluorochem | 1g | 2278.38 Pln | |
| Fluorochem | 5g | 6683.08 Pln |
| purity | 97% |
|---|---|
| delivery time | 3-4 weeks |
1,3-diazaspiro[4.5]decane-2,4,8-trione (CAS 51145-74-5) is a chemical compound with the molecular formula C8H10N2O3 and a molecular weight of 182.18 g/mol. IUPAC name: 1,3-diazaspiro[4.5]decane-2,4,8-trione. InChIKey: IVSBWJVHDCWNQR-UHFFFAOYSA-N.
| Molecular formula | C8H10N2O3 |
|---|---|
| Molecular weight | 182.18 g/mol |
| IUPAC name | 1,3-diazaspiro[4.5]decane-2,4,8-trione |
| InChIKey | IVSBWJVHDCWNQR-UHFFFAOYSA-N |
| SMILES | C1CC2(CCC1=O)C(=O)NC(=O)N2 |
Computed by PubChem (NCBI)