cas: 361436-26-2 — see every product listed under this CAS number, including other names
1,3-Dibromo-2-fluoro-5-nitrobenzene 97% (CAS 361436-26-2) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 5g, 10g, 25g, 100g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A111774-100mg |
| cas | 361436-26-2 |
| size | 100mg |
Ask us about this product — we're happy to help.
| brand | size | price | |
|---|---|---|---|
| Ambeed | 100mg | 120.06 Pln | |
| Ambeed | 250mg | 131.19 Pln | |
| Ambeed | 5g | 286.94 Pln | |
| Ambeed | 10g | 492.75 Pln | |
| Ambeed | 25g | 1126.88 Pln | |
| Ambeed | 100g | 3424.19 Pln |
| purity | 97% |
|---|---|
| delivery time | 1-2 weeks |
| ambeed catalog no. | A111774 |
1,3-dibromo-2-fluoro-5-nitrobenzene (CAS 361436-26-2) is a chemical compound with the molecular formula C6H2Br2FNO2 and a molecular weight of 298.89 g/mol. IUPAC name: 1,3-dibromo-2-fluoro-5-nitrobenzene. InChIKey: TUGFLGHTSGQDQE-UHFFFAOYSA-N.
| Molecular formula | C6H2Br2FNO2 |
|---|---|
| Molecular weight | 298.89 g/mol |
| IUPAC name | 1,3-dibromo-2-fluoro-5-nitrobenzene |
| InChIKey | TUGFLGHTSGQDQE-UHFFFAOYSA-N |
| SMILES | C1=C(C=C(C(=C1Br)F)Br)[N+](=O)[O-] |
Computed by PubChem (NCBI)