Products 1803785-06-9
CAS 1803785-06-9 appears in our catalog under these names: 1,5-Dibromo-2-fluoro-4-nitrobenzene 95%, 1,5-Dibromo-2-fluoro-4-nitrobenzene, 95%, 95%, 1,5-Dibromo-2-fluoro-4-nitrobenzene, 95%. Offered by: Ambeed, Chemat, Fluorochem. Available pack sizes: 250mg, 1g, 5g.
1,5-dibromo-2-fluoro-4-nitrobenzene (CAS 1803785-06-9) is a chemical compound with the molecular formula C6H2Br2FNO2 and a molecular weight of 298.89 g/mol. IUPAC name: 1,5-dibromo-2-fluoro-4-nitrobenzene. InChIKey: DXCYCYWVZMQAER-UHFFFAOYSA-N.
| Molecular formula | C6H2Br2FNO2 |
|---|---|
| Molecular weight | 298.89 g/mol |
| IUPAC name | 1,5-dibromo-2-fluoro-4-nitrobenzene |
| InChIKey | DXCYCYWVZMQAER-UHFFFAOYSA-N |
| SMILES | C1=C(C(=CC(=C1F)Br)Br)[N+](=O)[O-] |
Computed by PubChem (NCBI)