cas: 3107-19-5 — see every product listed under this CAS number, including other names
1,3-Dichloro-2-fluoro-5-nitrobenzene 98% (CAS 3107-19-5) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g, 25g, 100g, 500g, 1000g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A155741-1g |
| cas | 3107-19-5 |
| size | 1g |
Ask us about this product — we're happy to help.
| brand | size | price | |
|---|---|---|---|
| Ambeed | 1g | 175.69 Pln | |
| Ambeed | 5g | 197.94 Pln | |
| Ambeed | 25g | 220.19 Pln | |
| Ambeed | 100g | 303.62 Pln | |
| Ambeed | 500g | 687.44 Pln | |
| Ambeed | 1000g | 1115.75 Pln |
| purity | 98% |
|---|---|
| delivery time | 1-2 weeks |
| ambeed catalog no. | A155741 |
1,3-dichloro-2-fluoro-5-nitrobenzene (CAS 3107-19-5) is a chemical compound with the molecular formula C6H2Cl2FNO2 and a molecular weight of 209.99 g/mol. IUPAC name: 1,3-dichloro-2-fluoro-5-nitrobenzene. InChIKey: VMAATSFMXSMKPG-UHFFFAOYSA-N.
| Molecular formula | C6H2Cl2FNO2 |
|---|---|
| Molecular weight | 209.99 g/mol |
| IUPAC name | 1,3-dichloro-2-fluoro-5-nitrobenzene |
| InChIKey | VMAATSFMXSMKPG-UHFFFAOYSA-N |
| SMILES | C1=C(C=C(C(=C1Cl)F)Cl)[N+](=O)[O-] |
Computed by PubChem (NCBI)