cas: 3107-19-5 — see every product listed under this CAS number, including other names
1,3-Dichloro-2-fluoro-5-nitrobenzene, 98%, 98% (CAS 3107-19-5) is a chemical reagent available from Chemat. Available pack sizes: 5g, 10g, 25g, 50g, 100g, 250g, 500g, 1kg. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch114338-5g |
| cas | 3107-19-5 |
| size | 5g |
| availability | 8723.1g |
Ask us about this product — we're happy to help.
| brand | size | price | |
|---|---|---|---|
| Chemat | 5g | 69.20 Pln | |
| Chemat | 10g | 74.00 Pln | |
| Chemat | 25g | 74.00 Pln | |
| Chemat | 50g | 88.40 Pln | |
| Chemat | 100g | 102.80 Pln | |
| Chemat | 250g | 160.40 Pln | |
| Chemat | 500g | 326.40 Pln | |
| Chemat | 1kg | 558.80 Pln | |
| Chemat | 5kg | 2726.40 Pln |
| purity | 98% |
|---|---|
| delivery time | 3 weeks |
1,3-dichloro-2-fluoro-5-nitrobenzene (CAS 3107-19-5) is a chemical compound with the molecular formula C6H2Cl2FNO2 and a molecular weight of 209.99 g/mol. IUPAC name: 1,3-dichloro-2-fluoro-5-nitrobenzene. InChIKey: VMAATSFMXSMKPG-UHFFFAOYSA-N.
| Molecular formula | C6H2Cl2FNO2 |
|---|---|
| Molecular weight | 209.99 g/mol |
| IUPAC name | 1,3-dichloro-2-fluoro-5-nitrobenzene |
| InChIKey | VMAATSFMXSMKPG-UHFFFAOYSA-N |
| SMILES | C1=C(C=C(C(=C1Cl)F)Cl)[N+](=O)[O-] |
Computed by PubChem (NCBI)