cas: 29682-46-0 — see every product listed under this CAS number, including other names
1,3-Dichloro-2-methyl-4-nitrobenzene, 98% (CAS 29682-46-0) is a chemical reagent available from Chemat. Available pack sizes: 5g, 1g, 25g. Offered by: AmBeed, Fluorochem.
| brand | AmBeed |
|---|---|
| catalog number | A177896-5g |
| cas | 29682-46-0 |
| size | 5g |
| availability | Synthetic Items: 0g |
| brand | size | price | |
|---|---|---|---|
| AmBeed | 5g | 200.20 Pln | |
| AmBeed | 1g | 154.63 Pln | |
| Fluorochem | 25g | 107.27 Pln |
| purity | 98% |
|---|---|
| delivery time | To be confirmed by Chemat |
1,3-dichloro-2-methyl-4-nitrobenzene (CAS 29682-46-0) is a chemical compound with the molecular formula C7H5Cl2NO2 and a molecular weight of 206.02 g/mol. IUPAC name: 1,3-dichloro-2-methyl-4-nitrobenzene. InChIKey: WBNZUUIFTPNYRN-UHFFFAOYSA-N.
| Molecular formula | C7H5Cl2NO2 |
|---|---|
| Molecular weight | 206.02 g/mol |
| IUPAC name | 1,3-dichloro-2-methyl-4-nitrobenzene |
| InChIKey | WBNZUUIFTPNYRN-UHFFFAOYSA-N |
| SMILES | CC1=C(C=CC(=C1Cl)[N+](=O)[O-])Cl |
Computed by PubChem (NCBI)