Products 50917-28-7
CAS 50917-28-7 appears in our catalog under these names: 3-Amino-2,4-dichlorobenzoic acid, 98%, 3-Amino-2,4-dichlorobenzoic acid, 3-Amino-2,4-dichlorobenzoic acid 98%, 3-Amino-2,4-dichlorobenzoic acid, 98%, 98%, Benzoic acid, 3-amino-2,4-dichloro- (7CI,9CI), 98%. Offered by: Combi-blocks, Biosynth, Ambeed, Chemat, Fluorochem. Available pack sizes: 250mg, 5g, 1g, 0,5g, 100mg.
3-amino-2,4-dichlorobenzoic acid (CAS 50917-28-7) is a chemical compound with the molecular formula C7H5Cl2NO2 and a molecular weight of 206.02 g/mol. IUPAC name: 3-amino-2,4-dichlorobenzoic acid. InChIKey: MWIWETSWQFRAPN-UHFFFAOYSA-N.
| Molecular formula | C7H5Cl2NO2 |
|---|---|
| Molecular weight | 206.02 g/mol |
| IUPAC name | 3-amino-2,4-dichlorobenzoic acid |
| InChIKey | MWIWETSWQFRAPN-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C(=C1C(=O)O)Cl)N)Cl |
Computed by PubChem (NCBI)