CAS 62774-90-7 appears in our catalog under these names: 2,6-Dichloro-4-methyl-3-pyridinecarboxylic acid, 98%, 2,6-Dichloro-4-methylnicotinic acid 97%, 2,6-Dichloro-4-methyl-3-pyridinecarboxylic Acid, 98%, 98%, 2,6-Dichloro-4-methyl-3-pyridinecarboxylic acid, 97%. Offered by: Combi-blocks, Ambeed, Chemat, Fluorochem. Available pack sizes: 1g, 25g, 5g, 100g, 500g, 10g, 1kg, 5kg.
2,6-dichloro-4-methylpyridine-3-carboxylic acid (CAS 62774-90-7) is a chemical compound with the molecular formula C7H5Cl2NO2 and a molecular weight of 206.02 g/mol. IUPAC name: 2,6-dichloro-4-methylpyridine-3-carboxylic acid. InChIKey: QOSNTWMXACGOMD-UHFFFAOYSA-N.
| Molecular formula | C7H5Cl2NO2 |
|---|---|
| Molecular weight | 206.02 g/mol |
| IUPAC name | 2,6-dichloro-4-methylpyridine-3-carboxylic acid |
| InChIKey | QOSNTWMXACGOMD-UHFFFAOYSA-N |
| SMILES | CC1=CC(=NC(=C1C(=O)O)Cl)Cl |
Computed by PubChem (NCBI)