CAS 19861-63-3 appears in our catalog under these names: 5-Amino-2,4-dichlorobenzoic acid, 95%, 5-Amino-2,4-dichlorobenzoic acid, 98%, 5-Amino-2,4-dichlorobenzoic acid, 98%, 98%. Offered by: Combi-blocks, AmBeed, Chemat, Fluorochem. Available pack sizes: 5g, 1g, 250mg, 10g, 100mg.
5-amino-2,4-dichlorobenzoic acid (CAS 19861-63-3) is a chemical compound with the molecular formula C7H5Cl2NO2 and a molecular weight of 206.02 g/mol. IUPAC name: 5-amino-2,4-dichlorobenzoic acid. InChIKey: GWQAKTJQXQZZNO-UHFFFAOYSA-N.
| Molecular formula | C7H5Cl2NO2 |
|---|---|
| Molecular weight | 206.02 g/mol |
| IUPAC name | 5-amino-2,4-dichlorobenzoic acid |
| InChIKey | GWQAKTJQXQZZNO-UHFFFAOYSA-N |
| SMILES | C1=C(C(=CC(=C1N)Cl)Cl)C(=O)O |
Computed by PubChem (NCBI)