CAS 1256835-40-1 appears in our catalog under these names: 2,6-Dichloro-3-methylisonicotinic acid, 95%, 2,6–Dichloro–3–methylisonicotinic acid, 2,6-Dichloro-3-methylisonicotinic acid, 95%, 95%. Offered by: Combi-blocks, GLPBio, Chemat, Fluorochem. Available pack sizes: 1g, 100mg, 250mg.
2,6-dichloro-3-methylpyridine-4-carboxylic acid (CAS 1256835-40-1) is a chemical compound with the molecular formula C7H5Cl2NO2 and a molecular weight of 206.02 g/mol. IUPAC name: 2,6-dichloro-3-methylpyridine-4-carboxylic acid. InChIKey: TWYNDQHXDSFICB-UHFFFAOYSA-N.
| Molecular formula | C7H5Cl2NO2 |
|---|---|
| Molecular weight | 206.02 g/mol |
| IUPAC name | 2,6-dichloro-3-methylpyridine-4-carboxylic acid |
| InChIKey | TWYNDQHXDSFICB-UHFFFAOYSA-N |
| SMILES | CC1=C(N=C(C=C1C(=O)O)Cl)Cl |
Computed by PubChem (NCBI)