CAS 20776-61-8 appears in our catalog under these names: 2-Amino-4,5-dichlorobenzoic acid, 98%, 2–Amino–4,5–dichlorobenzoic acid, 2-Amino-4,5-dichlorobenzoic acid, 97%. Offered by: Combi-blocks, GLPBio, Fluorochem. Available pack sizes: 10g, 5g, 25g, 1g, 250mg.
2-amino-4,5-dichlorobenzoic acid (CAS 20776-61-8) is a chemical compound with the molecular formula C7H5Cl2NO2 and a molecular weight of 206.02 g/mol. IUPAC name: 2-amino-4,5-dichlorobenzoic acid. InChIKey: MQWFRBVVABTUKS-UHFFFAOYSA-N.
| Molecular formula | C7H5Cl2NO2 |
|---|---|
| Molecular weight | 206.02 g/mol |
| IUPAC name | 2-amino-4,5-dichlorobenzoic acid |
| InChIKey | MQWFRBVVABTUKS-UHFFFAOYSA-N |
| SMILES | C1=C(C(=CC(=C1Cl)Cl)N)C(=O)O |
Computed by PubChem (NCBI)