Products 50917-33-4

CAS 50917-33-4 is the registry number for 4-Amino-2,5-dichlorobenzoic acid, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 5g.

Structural formula: {0} (CAS {1})

4-amino-2,5-dichlorobenzoic acid (CAS 50917-33-4) is a chemical compound with the molecular formula C7H5Cl2NO2 and a molecular weight of 206.02 g/mol. IUPAC name: 4-amino-2,5-dichlorobenzoic acid. InChIKey: IFEACDHORUZYIT-UHFFFAOYSA-N.

Identity
Molecular formulaC7H5Cl2NO2
Molecular weight206.02 g/mol
IUPAC name4-amino-2,5-dichlorobenzoic acid
InChIKeyIFEACDHORUZYIT-UHFFFAOYSA-N
SMILESC1=C(C(=CC(=C1Cl)N)Cl)C(=O)O

Computed by PubChem (NCBI)