CAS 50917-33-4 is the registry number for 4-Amino-2,5-dichlorobenzoic acid, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 5g.
4-amino-2,5-dichlorobenzoic acid (CAS 50917-33-4) is a chemical compound with the molecular formula C7H5Cl2NO2 and a molecular weight of 206.02 g/mol. IUPAC name: 4-amino-2,5-dichlorobenzoic acid. InChIKey: IFEACDHORUZYIT-UHFFFAOYSA-N.
| Molecular formula | C7H5Cl2NO2 |
|---|---|
| Molecular weight | 206.02 g/mol |
| IUPAC name | 4-amino-2,5-dichlorobenzoic acid |
| InChIKey | IFEACDHORUZYIT-UHFFFAOYSA-N |
| SMILES | C1=C(C(=CC(=C1Cl)N)Cl)C(=O)O |
Computed by PubChem (NCBI)