cas: 601-88-7 — see every product listed under this CAS number, including other names
1,3-Dichloro-2-nitrobenzene 98% (CAS 601-88-7) is a chemical reagent available from Chemat. Available pack sizes: 5g, 10g, 25g, 100g, 500g, 1000g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A492879-5g |
| cas | 601-88-7 |
| size | 5g |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 5g | 120.06 Pln | |
| Ambeed | 10g | 131.19 Pln | |
| Ambeed | 25g | 147.88 Pln | |
| Ambeed | 100g | 331.44 Pln | |
| Ambeed | 500g | 1293.75 Pln | |
| Ambeed | 1000g | 2155.94 Pln |
| purity | 98% |
|---|---|
| delivery time | 1-2 weeks |
| ambeed catalog no. | A492879 |
1,3-dichloro-2-nitrobenzene (CAS 601-88-7) is a chemical compound with the molecular formula C6H3Cl2NO2 and a molecular weight of 192.00 g/mol. IUPAC name: 1,3-dichloro-2-nitrobenzene. InChIKey: VITSNECNFNNVQB-UHFFFAOYSA-N.
| Molecular formula | C6H3Cl2NO2 |
|---|---|
| Molecular weight | 192.00 g/mol |
| IUPAC name | 1,3-dichloro-2-nitrobenzene |
| InChIKey | VITSNECNFNNVQB-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C(=C1)Cl)[N+](=O)[O-])Cl |
Computed by PubChem (NCBI)