Products 88912-24-7
CAS 88912-24-7 appears in our catalog under these names: 5,6–Dichloropicolinic acid, 5,6-Dichloropyridine-2-carboxylic acid, 98% , 5,6-Dichloropicolinic acid 98%, 5,6-Dichloropicolinic acid, 98%, 98%, 5,6-Dichloropicolinic acid, 96%. Offered by: GLPBio, Thermo Scientific (Alfa Aesar), Ambeed, Chemat, Fluorochem. Available pack sizes: 1g, 250mg, 25g, 5g, 10g, 100g, 500g.
5,6-dichloropyridine-2-carboxylic acid (CAS 88912-24-7) is a chemical compound with the molecular formula C6H3Cl2NO2 and a molecular weight of 192.00 g/mol. IUPAC name: 5,6-dichloropyridine-2-carboxylic acid. InChIKey: QOJNAEPFSUYAFL-UHFFFAOYSA-N.
| Molecular formula | C6H3Cl2NO2 |
|---|---|
| Molecular weight | 192.00 g/mol |
| IUPAC name | 5,6-dichloropyridine-2-carboxylic acid |
| InChIKey | QOJNAEPFSUYAFL-UHFFFAOYSA-N |
| SMILES | C1=CC(=NC(=C1Cl)Cl)C(=O)O |
Computed by PubChem (NCBI)