cas: 89692-81-9 — see every product listed under this CAS number, including other names
1,3-Dichloro-5-methyl-2-nitrobenzene, 97%, 97% (CAS 89692-81-9) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch11IFST-100mg |
| cas | 89692-81-9 |
| size | 100mg |
| availability | 2g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 98.00 Pln | |
| Chemat | 250mg | 98.00 Pln |
| purity | 97% |
|---|---|
| delivery time | 3 weeks |
1,3-dichloro-5-methyl-2-nitrobenzene (CAS 89692-81-9) is a chemical compound with the molecular formula C7H5Cl2NO2 and a molecular weight of 206.02 g/mol. IUPAC name: 1,3-dichloro-5-methyl-2-nitrobenzene. InChIKey: POAILBXQTJDSFV-UHFFFAOYSA-N.
| Molecular formula | C7H5Cl2NO2 |
|---|---|
| Molecular weight | 206.02 g/mol |
| IUPAC name | 1,3-dichloro-5-methyl-2-nitrobenzene |
| InChIKey | POAILBXQTJDSFV-UHFFFAOYSA-N |
| SMILES | CC1=CC(=C(C(=C1)Cl)[N+](=O)[O-])Cl |
Computed by PubChem (NCBI)