1,4-Di(4H-1,2,4-triazol-4-yl)benzene, 97%
cas: 681004-60-4 — see every product listed under this CAS number, including other names
1,4-Di(4H-1,2,4-triazol-4-yl)benzene, 97% (CAS 681004-60-4) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g. Offered by: Fluorochem, Ambeed, Chemat.
| brand | Fluorochem |
|---|---|
| catalog number | F617433-100MG |
| cas | 681004-60-4 |
| size | 100mg |
| availability | In Stock China |
Documents:
Safety Data Sheet (MSDS)
Need more information?
Ask us about this product — we're happy to help.
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 100mg | 279.09 Pln | |
| Fluorochem | 250mg | 310.33 Pln | |
| Fluorochem | 1g | 716.43 Pln | |
| Fluorochem | 5g | 2231.52 Pln | |
| Ambeed | 100mg | 203.50 Pln | |
| Ambeed | 250mg | 309.19 Pln | |
| Ambeed | 1g | 698.56 Pln | |
| Ambeed | 5g | 2167.06 Pln | |
| Chemat | 100mg | 165.20 Pln | |
| Chemat | 250mg | 246.80 Pln | |
| Chemat | 1g | 539.60 Pln | |
| Chemat | 5g | 1634.00 Pln |
properties
| purity | 97% |
|---|---|
| dual use | No |
| currency | EUR |
| delivery time | 2-3 weeks |
| category | Odczynniki chemiczne |
4-[4-(1,2,4-triazol-4-yl)phenyl]-1,2,4-triazole (CAS 681004-60-4) is a chemical compound with the molecular formula C10H8N6 and a molecular weight of 212.21 g/mol. IUPAC name: 4-[4-(1,2,4-triazol-4-yl)phenyl]-1,2,4-triazole. InChIKey: YLVOERRBUWBZGC-UHFFFAOYSA-N.
| Molecular formula | C10H8N6 |
|---|---|
| Molecular weight | 212.21 g/mol |
| IUPAC name | 4-[4-(1,2,4-triazol-4-yl)phenyl]-1,2,4-triazole |
| InChIKey | YLVOERRBUWBZGC-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1N2C=NN=C2)N3C=NN=C3 |
Computed by PubChem (NCBI)