CAS 17918-58-0 is the registry number for 3,5-Dihydro-3,5-diiminobenzo[1,2-c:4,5-c′]dipyrrole-1,7-diamine, 95%, 95%. Offered by: Chemat. Available pack sizes: 100mg, 250mg.
1,7-diiminopyrrolo[3,4-f]isoindole-3,5-diamine (CAS 17918-58-0) is a chemical compound with the molecular formula C10H8N6 and a molecular weight of 212.21 g/mol. IUPAC name: 1,7-diiminopyrrolo[3,4-f]isoindole-3,5-diamine. InChIKey: RRAPLYNIIXTZEZ-UHFFFAOYSA-N.
| Molecular formula | C10H8N6 |
|---|---|
| Molecular weight | 212.21 g/mol |
| IUPAC name | 1,7-diiminopyrrolo[3,4-f]isoindole-3,5-diamine |
| InChIKey | RRAPLYNIIXTZEZ-UHFFFAOYSA-N |
| SMILES | C1=C2C(=CC3=C1C(=NC3=N)N)C(=N)N=C2N |
Computed by PubChem (NCBI)