CAS 1493805-13-2 appears in our catalog under these names: 1,3-Di(4H-1,2,4-triazol-4-yl)benzene, 95%, 95%, 1,3-Di(4H-1,2,4-triazol-4-yl)benzene, 95%. Offered by: Chemat, Fluorochem, Ambeed. Available pack sizes: 100mg, 250mg, 1g.
4-[3-(1,2,4-triazol-4-yl)phenyl]-1,2,4-triazole (CAS 1493805-13-2) is a chemical compound with the molecular formula C10H8N6 and a molecular weight of 212.21 g/mol. IUPAC name: 4-[3-(1,2,4-triazol-4-yl)phenyl]-1,2,4-triazole. InChIKey: HVMMGTLUNJNHFE-UHFFFAOYSA-N.
| Molecular formula | C10H8N6 |
|---|---|
| Molecular weight | 212.21 g/mol |
| IUPAC name | 4-[3-(1,2,4-triazol-4-yl)phenyl]-1,2,4-triazole |
| InChIKey | HVMMGTLUNJNHFE-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC(=C1)N2C=NN=C2)N3C=NN=C3 |
Computed by PubChem (NCBI)