CAS 681004-60-4 appears in our catalog under these names: 1,4–Di(4H–1,2,4–triazol–4–yl)benzene, 1,4-Di(4H-1,2,4-triazol-4-yl)benzene, 97%, 97%, 1,4-Di(4H-1,2,4-triazol-4-yl)benzene, 97%. Offered by: GLPBio, Chemat, Fluorochem, Ambeed. Available pack sizes: 1g, 250mg, 5g, 100mg.
4-[4-(1,2,4-triazol-4-yl)phenyl]-1,2,4-triazole (CAS 681004-60-4) is a chemical compound with the molecular formula C10H8N6 and a molecular weight of 212.21 g/mol. IUPAC name: 4-[4-(1,2,4-triazol-4-yl)phenyl]-1,2,4-triazole. InChIKey: YLVOERRBUWBZGC-UHFFFAOYSA-N.
| Molecular formula | C10H8N6 |
|---|---|
| Molecular weight | 212.21 g/mol |
| IUPAC name | 4-[4-(1,2,4-triazol-4-yl)phenyl]-1,2,4-triazole |
| InChIKey | YLVOERRBUWBZGC-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1N2C=NN=C2)N3C=NN=C3 |
Computed by PubChem (NCBI)