CAS 1329836-75-0 is the registry number for 1,1'-(1,3-Phenylene)bis-1H-1,2,4-triazole-15N4. Offered by: TRC. Available pack sizes: 25mg.
1-[3-((1,2,4-15N3)1,2,4-triazol-1-yl)phenyl]-(115N)1,2,4-triazole (CAS 1329836-75-0) is a chemical compound with the molecular formula C10H8N6 and a molecular weight of 216.18 g/mol. IUPAC name: 1-[3-((1,2,4-15N3)1,2,4-triazol-1-yl)phenyl]-(115N)1,2,4-triazole. InChIKey: WXNXRKYXCCDJHI-ICZKCAEDSA-N.
| Molecular formula | C10H8N6 |
|---|---|
| Molecular weight | 216.18 g/mol |
| IUPAC name | 1-[3-((1,2,4-15N3)1,2,4-triazol-1-yl)phenyl]-(115N)1,2,4-triazole |
| InChIKey | WXNXRKYXCCDJHI-ICZKCAEDSA-N |
| SMILES | C1=CC(=CC(=C1)[15N]2C=NC=N2)[15N]3C=[15N]C=[15N]3 |
Computed by PubChem (NCBI)