CAS 1020252-60-1 is the registry number for 2-(2H-2,3,4,5-Tetraazolyl)-3-(phenylamino)prop-2-enenitrile. Offered by: Biosynth. Available pack sizes: 5000mg.
(E)-3-anilino-2-(2H-tetrazol-5-yl)prop-2-enenitrile (CAS 1020252-60-1) is a chemical compound with the molecular formula C10H8N6 and a molecular weight of 212.21 g/mol. IUPAC name: (E)-3-anilino-2-(2H-tetrazol-5-yl)prop-2-enenitrile. InChIKey: SOXCTISAYHQOEE-BQYQJAHWSA-N.
| Molecular formula | C10H8N6 |
|---|---|
| Molecular weight | 212.21 g/mol |
| IUPAC name | (E)-3-anilino-2-(2H-tetrazol-5-yl)prop-2-enenitrile |
| InChIKey | SOXCTISAYHQOEE-BQYQJAHWSA-N |
| SMILES | C1=CC=C(C=C1)N/C=C(\C#N)/C2=NNN=N2 |
Computed by PubChem (NCBI)