CAS 1435710-71-6 appears in our catalog under these names: 1,4–Di(1H–1,2,4–triazol–1–yl)benzene, 1,4-Di(1H-1,2,4-triazol-1-yl)benzene, 98%, 98%, 1,4-Di(1H-1,2,4-triazol-1-yl)benzene, 98%. Offered by: GLPBio, Chemat, Fluorochem, Ambeed. Available pack sizes: 1g, 5g, 100mg, 250mg, 25g.
1-[4-(1,2,4-triazol-1-yl)phenyl]-1,2,4-triazole (CAS 1435710-71-6) is a chemical compound with the molecular formula C10H8N6 and a molecular weight of 212.21 g/mol. IUPAC name: 1-[4-(1,2,4-triazol-1-yl)phenyl]-1,2,4-triazole. InChIKey: NCHJBELAOOWIPK-UHFFFAOYSA-N.
| Molecular formula | C10H8N6 |
|---|---|
| Molecular weight | 212.21 g/mol |
| IUPAC name | 1-[4-(1,2,4-triazol-1-yl)phenyl]-1,2,4-triazole |
| InChIKey | NCHJBELAOOWIPK-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1N2C=NC=N2)N3C=NC=N3 |
Computed by PubChem (NCBI)