cas: 366496-33-5 — see every product listed under this CAS number, including other names
1,4-Dibromo-2-fluoro-5-nitrobenzene 97% (CAS 366496-33-5) is a chemical reagent available from Chemat. Available pack sizes: 1000g, 1g, 5g, 10g, 25g, 100g, 500g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A469133-1000g |
| cas | 366496-33-5 |
| size | 1000g |
Ask us about this product — we're happy to help.
| brand | size | price | |
|---|---|---|---|
| Ambeed | 1000g | 4342.00 Pln | |
| Ambeed | 1g | 120.06 Pln | |
| Ambeed | 5g | 131.19 Pln | |
| Ambeed | 10g | 164.56 Pln | |
| Ambeed | 25g | 192.38 Pln | |
| Ambeed | 100g | 542.81 Pln | |
| Ambeed | 500g | 2372.88 Pln |
| purity | 97% |
|---|---|
| delivery time | 1-2 weeks |
| ambeed catalog no. | A469133 |
1,4-dibromo-2-fluoro-5-nitrobenzene (CAS 366496-33-5) is a chemical compound with the molecular formula C6H2Br2FNO2 and a molecular weight of 298.89 g/mol. IUPAC name: 1,4-dibromo-2-fluoro-5-nitrobenzene. InChIKey: WDFCYQDGGDTTCT-UHFFFAOYSA-N.
| Molecular formula | C6H2Br2FNO2 |
|---|---|
| Molecular weight | 298.89 g/mol |
| IUPAC name | 1,4-dibromo-2-fluoro-5-nitrobenzene |
| InChIKey | WDFCYQDGGDTTCT-UHFFFAOYSA-N |
| SMILES | C1=C(C(=CC(=C1Br)F)Br)[N+](=O)[O-] |
Computed by PubChem (NCBI)