cas: 7149-76-0 — see every product listed under this CAS number, including other names
1,4-Dichloro-2-methyl-5-nitrobenzene, 98%, 98% (CAS 7149-76-0) is a chemical reagent available from Chemat. Available pack sizes: 50mg, 100mg, 250mg, 1g, 5g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch11FAAV-50mg |
| cas | 7149-76-0 |
| size | 50mg |
| availability | 10g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 50mg | 266.00 Pln | |
| Chemat | 100mg | 371.60 Pln | |
| Chemat | 250mg | 506.00 Pln | |
| Chemat | 1g | 1269.20 Pln | |
| Chemat | 5g | 3750.80 Pln |
| purity | 98% |
|---|---|
| delivery time | 3 weeks |
1,4-dichloro-2-methyl-5-nitrobenzene (CAS 7149-76-0) is a chemical compound with the molecular formula C7H5Cl2NO2 and a molecular weight of 206.02 g/mol. IUPAC name: 1,4-dichloro-2-methyl-5-nitrobenzene. InChIKey: PEQYJEJKUTUIFJ-UHFFFAOYSA-N.
| Molecular formula | C7H5Cl2NO2 |
|---|---|
| Molecular weight | 206.02 g/mol |
| IUPAC name | 1,4-dichloro-2-methyl-5-nitrobenzene |
| InChIKey | PEQYJEJKUTUIFJ-UHFFFAOYSA-N |
| SMILES | CC1=CC(=C(C=C1Cl)[N+](=O)[O-])Cl |
Computed by PubChem (NCBI)