1,4-Phenylene diacetate, 98%
cas: 1205-91-0 — see every product listed under this CAS number, including other names
1,4-Phenylene diacetate, 98% (CAS 1205-91-0) is a chemical reagent available from Chemat. Available pack sizes: 5g, 10g, 25g, 50g, 100g, 250g, 500g. Offered by: Chemat, BLDpharm.
| brand | Chemat |
|---|---|
| catalog number | Ch114B1K-5g |
| cas | 1205-91-0 |
| size | 5g |
| availability | 300g |
Need more information?
Ask us about this product — we're happy to help.
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Chemat | 5g | 78.80 Pln | |
| Chemat | 10g | 93.20 Pln | |
| Chemat | 25g | 107.60 Pln | |
| Chemat | 50g | 155.60 Pln | |
| Chemat | 100g | 227.60 Pln | |
| Chemat | 250g | 472.40 Pln | |
| BLDpharm | 5g | 125.54 Pln | |
| BLDpharm | 25g | 158.86 Pln | |
| BLDpharm | 100g | 375.45 Pln | |
| BLDpharm | 500g | 1202.93 Pln |
properties
| purity | 98% |
|---|---|
| delivery time | 3 weeks |
(4-acetyloxyphenyl) acetate (CAS 1205-91-0) is a chemical compound with the molecular formula C10H10O4 and a molecular weight of 194.18 g/mol. IUPAC name: (4-acetyloxyphenyl) acetate. InChIKey: AKOGNYJNGMLDOA-UHFFFAOYSA-N.
| Molecular formula | C10H10O4 |
|---|---|
| Molecular weight | 194.18 g/mol |
| IUPAC name | (4-acetyloxyphenyl) acetate |
| InChIKey | AKOGNYJNGMLDOA-UHFFFAOYSA-N |
| SMILES | CC(=O)OC1=CC=C(C=C1)OC(=O)C |
Computed by PubChem (NCBI)