1,5-Dibromo-2-fluoro-4-nitrobenzene, 95%
cas: 1803785-06-9 — see every product listed under this CAS number, including other names
1,5-Dibromo-2-fluoro-4-nitrobenzene, 95% (CAS 1803785-06-9) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g. Offered by: Ambeed, BLDpharm, Chemat, Fluorochem.
| brand | Ambeed |
|---|---|
| catalog number | A501335-250mg |
| cas | 1803785-06-9 |
| size | 250mg |
Need more information?
Ask us about this product — we're happy to help.
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Ambeed | 250mg | 231.31 Pln | |
| Ambeed | 1g | 470.50 Pln | |
| Ambeed | 5g | 1449.50 Pln | |
| BLDpharm | 250mg | 236.61 Pln | |
| BLDpharm | 1g | 503.18 Pln | |
| BLDpharm | 5g | 1558.36 Pln | |
| Chemat | 250mg | 170.00 Pln | |
| Chemat | 1g | 352.40 Pln | |
| Chemat | 5g | 1072.40 Pln | |
| Fluorochem | 250mg | 294.71 Pln | |
| Fluorochem | 1g | 638.33 Pln | |
| Fluorochem | 5g | 1981.61 Pln |
properties
| purity | 95% |
|---|---|
| delivery time | 2-3 weeks |
1,5-dibromo-2-fluoro-4-nitrobenzene (CAS 1803785-06-9) is a chemical compound with the molecular formula C6H2Br2FNO2 and a molecular weight of 298.89 g/mol. IUPAC name: 1,5-dibromo-2-fluoro-4-nitrobenzene. InChIKey: DXCYCYWVZMQAER-UHFFFAOYSA-N.
| Molecular formula | C6H2Br2FNO2 |
|---|---|
| Molecular weight | 298.89 g/mol |
| IUPAC name | 1,5-dibromo-2-fluoro-4-nitrobenzene |
| InChIKey | DXCYCYWVZMQAER-UHFFFAOYSA-N |
| SMILES | C1=C(C(=CC(=C1F)Br)Br)[N+](=O)[O-] |
Computed by PubChem (NCBI)