cas: 4869-45-8 — see every product listed under this CAS number, including other names
1,3-Dimethyl-2,4-dioxo-1,2,3,4-tetrahydropyrimidine-5-carboxylic Acid, 98%, 98% (CAS 4869-45-8) is a chemical reagent available from Chemat. Available pack sizes: 100g, 100mg, 250mg, 1g, 5g, 10g, 25g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch114DKA-100g |
| cas | 4869-45-8 |
| size | 100g |
| availability | 500g |
Ask us about this product — we're happy to help.
| brand | size | price | |
|---|---|---|---|
| Chemat | 100g | 8334.80 Pln | |
| Chemat | 100mg | 78.80 Pln | |
| Chemat | 250mg | 88.40 Pln | |
| Chemat | 1g | 146.00 Pln | |
| Chemat | 5g | 477.20 Pln | |
| Chemat | 10g | 894.80 Pln | |
| Chemat | 25g | 2128.40 Pln |
| purity | 98% |
|---|---|
| delivery time | 3 weeks |
1,3-dimethyl-2,4-dioxopyrimidine-5-carboxylic acid (CAS 4869-45-8) is a chemical compound with the molecular formula C7H8N2O4 and a molecular weight of 184.15 g/mol. IUPAC name: 1,3-dimethyl-2,4-dioxopyrimidine-5-carboxylic acid. InChIKey: OQOZKHDSUDJUDR-UHFFFAOYSA-N.
| Molecular formula | C7H8N2O4 |
|---|---|
| Molecular weight | 184.15 g/mol |
| IUPAC name | 1,3-dimethyl-2,4-dioxopyrimidine-5-carboxylic acid |
| InChIKey | OQOZKHDSUDJUDR-UHFFFAOYSA-N |
| SMILES | CN1C=C(C(=O)N(C1=O)C)C(=O)O |
Computed by PubChem (NCBI)