CAS 143469-00-5 appears in our catalog under these names: ([(5-Methylisoxazol-4-yl)carbonyl]amino)acetic acid, 95%, 2-((5-Methyl-1,2-oxazol-4-yl)formamido)acetic acid, 95%, 2-((5-Methyl-1,2-oxazol-4-yl)formamido)acetic acid. Offered by: Combi-blocks, AmBeed, Biosynth. Available pack sizes: 5g, 1g, 10g, 250mg, 100mg, 0,5g.
2-[(5-methyl-1,2-oxazole-4-carbonyl)amino]acetic acid (CAS 143469-00-5) is a chemical compound with the molecular formula C7H8N2O4 and a molecular weight of 184.15 g/mol. IUPAC name: 2-[(5-methyl-1,2-oxazole-4-carbonyl)amino]acetic acid. InChIKey: WTYRDMBLJXBKGB-UHFFFAOYSA-N.
| Molecular formula | C7H8N2O4 |
|---|---|
| Molecular weight | 184.15 g/mol |
| IUPAC name | 2-[(5-methyl-1,2-oxazole-4-carbonyl)amino]acetic acid |
| InChIKey | WTYRDMBLJXBKGB-UHFFFAOYSA-N |
| SMILES | CC1=C(C=NO1)C(=O)NCC(=O)O |
Computed by PubChem (NCBI)