CAS 4869-45-8 appears in our catalog under these names: 1,3–Dimethyl–2,4–dioxo–1,2,3,4–tetrahydropyrimidine–5–carboxylic Acid, 1,3-Dimethyl-2,4-dioxo-1,2,3,4-tetrahydropyrimidine-5-carboxylic acid, 1,3-Dimethyl-2,4-dioxo-1,2,3,4-tetrahydropyrimidine-5-carboxylic Acid, 98%, 98%, 1,3-DIMETHYL-2,4-DIOXO-1,2,3,4-TETRAHYDROPYRIMIDINE-5-CARBOXYLIC ACID, 98%. Offered by: GLPBio, Biosynth, Chemat, Fluorochem, Ambeed. Available pack sizes: 1g, 5g, 100g, 100mg, 250mg, 10g, 25g.
1,3-dimethyl-2,4-dioxopyrimidine-5-carboxylic acid (CAS 4869-45-8) is a chemical compound with the molecular formula C7H8N2O4 and a molecular weight of 184.15 g/mol. IUPAC name: 1,3-dimethyl-2,4-dioxopyrimidine-5-carboxylic acid. InChIKey: OQOZKHDSUDJUDR-UHFFFAOYSA-N.
| Molecular formula | C7H8N2O4 |
|---|---|
| Molecular weight | 184.15 g/mol |
| IUPAC name | 1,3-dimethyl-2,4-dioxopyrimidine-5-carboxylic acid |
| InChIKey | OQOZKHDSUDJUDR-UHFFFAOYSA-N |
| SMILES | CN1C=C(C(=O)N(C1=O)C)C(=O)O |
Computed by PubChem (NCBI)