cas: 1145-04-6 — see every product listed under this CAS number, including other names
1-((1,1'-Biphenyl)-4-yl)-2,2-dihydroxyethanone, 95% (CAS 1145-04-6) is a chemical reagent available from Chemat. Available pack sizes: 5g, 25g. Offered by: AmBeed.
| brand | AmBeed |
|---|---|
| catalog number | A634267-5g |
| cas | 1145-04-6 |
| size | 5g |
| availability | Synthetic Items: 0g |
| brand | size | price | |
|---|---|---|---|
| AmBeed | 5g | 11495.05 Pln | |
| AmBeed | 25g | 13897.24 Pln |
| purity | 95% |
|---|---|
| delivery time | To be confirmed by Chemat |
2,2-dihydroxy-1-(4-phenylphenyl)ethanone (CAS 1145-04-6) is a chemical compound with the molecular formula C14H12O3 and a molecular weight of 228.24 g/mol. IUPAC name: 2,2-dihydroxy-1-(4-phenylphenyl)ethanone. InChIKey: DNYMAUICCMLWCF-UHFFFAOYSA-N.
| Molecular formula | C14H12O3 |
|---|---|
| Molecular weight | 228.24 g/mol |
| IUPAC name | 2,2-dihydroxy-1-(4-phenylphenyl)ethanone |
| InChIKey | DNYMAUICCMLWCF-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)C2=CC=C(C=C2)C(=O)C(O)O |
Computed by PubChem (NCBI)