Products 77513-40-7
CAS 77513-40-7 appears in our catalog under these names: Benzyl 3-hydroxybenzoate, 98%, Benzyl 3–hydroxybenzoate, Benzyl 3-hydroxybenzoate 98%, Benzyl 3-Hydroxybenzoate, 98%, 98%, Benzyl 3-hydroxybenzoate. Offered by: Combi-blocks, GLPBio, Ambeed, Chemat, Fluorochem. Available pack sizes: 1g, 5g, 250mg, 100mg.
Benzyl 3-hydroxybenzoate (CAS 77513-40-7) is a chemical compound with the molecular formula C14H12O3 and a molecular weight of 228.24 g/mol. IUPAC name: benzyl 3-hydroxybenzoate. InChIKey: QCLMZTCDRVMSHA-UHFFFAOYSA-N.
| Molecular formula | C14H12O3 |
|---|---|
| Molecular weight | 228.24 g/mol |
| IUPAC name | benzyl 3-hydroxybenzoate |
| InChIKey | QCLMZTCDRVMSHA-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)COC(=O)C2=CC(=CC=C2)O |
Computed by PubChem (NCBI)