CAS 1145-04-6 appears in our catalog under these names: 4-Biphenylglyoxal hydrate, 95%, 1-((1,1'-Biphenyl)-4-yl)-2,2-dihydroxyethanone, 95%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 10g, 5g, 1g, 25g.
2,2-dihydroxy-1-(4-phenylphenyl)ethanone (CAS 1145-04-6) is a chemical compound with the molecular formula C14H12O3 and a molecular weight of 228.24 g/mol. IUPAC name: 2,2-dihydroxy-1-(4-phenylphenyl)ethanone. InChIKey: DNYMAUICCMLWCF-UHFFFAOYSA-N.
| Molecular formula | C14H12O3 |
|---|---|
| Molecular weight | 228.24 g/mol |
| IUPAC name | 2,2-dihydroxy-1-(4-phenylphenyl)ethanone |
| InChIKey | DNYMAUICCMLWCF-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)C2=CC=C(C=C2)C(=O)C(O)O |
Computed by PubChem (NCBI)