cas: 288251-60-5 — see every product listed under this CAS number, including other names
1-(2,2,2-Trifluoroethyl)-1H-pyrazole-4-carboxylic acid, 97%, 97% (CAS 288251-60-5) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch113WO2-100mg |
| cas | 288251-60-5 |
| size | 100mg |
| availability | 5g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 290.00 Pln | |
| Chemat | 250mg | 472.40 Pln | |
| Chemat | 1g | 947.60 Pln |
| purity | 97% |
|---|---|
| delivery time | 3 weeks |
1-(2,2,2-trifluoroethyl)pyrazole-4-carboxylic acid (CAS 288251-60-5) is a chemical compound with the molecular formula C6H5F3N2O2 and a molecular weight of 194.11 g/mol. IUPAC name: 1-(2,2,2-trifluoroethyl)pyrazole-4-carboxylic acid. InChIKey: VPAMEBUGVMETCV-UHFFFAOYSA-N.
| Molecular formula | C6H5F3N2O2 |
|---|---|
| Molecular weight | 194.11 g/mol |
| IUPAC name | 1-(2,2,2-trifluoroethyl)pyrazole-4-carboxylic acid |
| InChIKey | VPAMEBUGVMETCV-UHFFFAOYSA-N |
| SMILES | C1=C(C=NN1CC(F)(F)F)C(=O)O |
Computed by PubChem (NCBI)