cas: 33243-33-3 — see every product listed under this CAS number, including other names
1-(2,4-Dibromophenyl)ethanone, 98% (CAS 33243-33-3) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g, 25g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F215656-1G |
| cas | 33243-33-3 |
| size | 1g |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 1g | 190.58 Pln | |
| Fluorochem | 5g | 435.28 Pln | |
| Fluorochem | 25g | 1913.93 Pln |
| purity | 98% |
|---|---|
| delivery time | 1-2 weeks |
1-(2,4-dibromophenyl)ethanone (CAS 33243-33-3) is a chemical compound with the molecular formula C8H6Br2O and a molecular weight of 277.94 g/mol. IUPAC name: 1-(2,4-dibromophenyl)ethanone. InChIKey: PFNFQYGPUFVXPB-UHFFFAOYSA-N.
| Molecular formula | C8H6Br2O |
|---|---|
| Molecular weight | 277.94 g/mol |
| IUPAC name | 1-(2,4-dibromophenyl)ethanone |
| InChIKey | PFNFQYGPUFVXPB-UHFFFAOYSA-N |
| SMILES | CC(=O)C1=C(C=C(C=C1)Br)Br |
Computed by PubChem (NCBI)